C10H7ClFNO2 — CID 91017167
1-(4-chloro-3-fluorophenyl)-1-iminobutane-2,3-dione (PubChem CID 91017167) has the molecular formula C10H7ClFNO2 and a molecular weight of 227.62 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-1-iminobutane-2,3-dione.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-1-iminobutane-2,3-dione |
|---|---|
| PubChem CID | 91017167 |
| Molecular Formula | C10H7ClFNO2 |
| Molecular Weight | 227.62 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-1-iminobutane-2,3-dione |
| SMILES | [H]/N=C(\C(=O)C(C)=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H7ClFNO2/c1-5(14)10(15)9(13)6-2-3-7(11)8(12)4-6/h2-4,13H,1H3/b13-9- |
| InChIKey | UNCZJJUGHHRGSY-LCYFTJDESA-N |
| XLogP | 2.01 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.62 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|