C8H4F3NO2 — CID 175792577
2-imino-2-(2,4,5-trifluorophenyl)acetic acid (PubChem CID 175792577) has the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. Its IUPAC name is 2-imino-2-(2,4,5-trifluorophenyl)acetic acid.
| Compound Name | 2-imino-2-(2,4,5-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 175792577 |
| Molecular Formula | C8H4F3NO2 |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2-imino-2-(2,4,5-trifluorophenyl)acetic acid |
| SMILES | [H]/N=C(\C(=O)O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C8H4F3NO2/c9-4-2-6(11)5(10)1-3(4)7(12)8(13)14/h1-2,12H,(H,13,14)/b12-7- |
| InChIKey | XOLQHXDOADMPCX-GHXNOFRVSA-N |
| XLogP | 1.56 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|