C14H14F3NO3 — CID 135618129
(Z)-2-(tert-butyliminomethyl)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoic acid (PubChem CID 135618129) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is (Z)-2-(tert-butyliminomethyl)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(tert-butyliminomethyl)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 135618129 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (Z)-2-(tert-butyliminomethyl)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoic acid |
| SMILES | CC(C)(C)/N=C/C(C(=O)O)=C(/O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H14F3NO3/c1-14(2,3)18-6-8(13(20)21)12(19)7-4-10(16)11(17)5-9(7)15/h4-6,19H,1-3H3,(H,20,21)/b12-8-,18-6+ |
| InChIKey | JTOOZVLZNWLHGC-KDDZAYJOSA-N |
| XLogP | 3.33 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|