C13H13F3O3 — CID 54206049
2-ethyl-2-(2,4,5-trifluorobenzoyl)butanoic acid (PubChem CID 54206049) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-ethyl-2-(2,4,5-trifluorobenzoyl)butanoic acid.
| Compound Name | 2-ethyl-2-(2,4,5-trifluorobenzoyl)butanoic acid |
|---|---|
| PubChem CID | 54206049 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-ethyl-2-(2,4,5-trifluorobenzoyl)butanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H13F3O3/c1-3-13(4-2,12(18)19)11(17)7-5-9(15)10(16)6-8(7)14/h5-6H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | PSNMJWBENLZZCA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|