C13H13F3O4 — CID 68637487
2-ethyl-2-(2,3,5-trifluorophenoxy)carbonylbutanoic acid (PubChem CID 68637487) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-ethyl-2-(2,3,5-trifluorophenoxy)carbonylbutanoic acid.
| Compound Name | 2-ethyl-2-(2,3,5-trifluorophenoxy)carbonylbutanoic acid |
|---|---|
| PubChem CID | 68637487 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-ethyl-2-(2,3,5-trifluorophenoxy)carbonylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)Oc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H13F3O4/c1-3-13(4-2,11(17)18)12(19)20-9-6-7(14)5-8(15)10(9)16/h5-6H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | LTCMSFQMJBPOCL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|