C16H21N3OS2 — CID 144620733
1-(1,3-benzothiazol-2-ylmethyl)-4-methyl-3-(2-methyl-2-sulfanylpropyl)imidazolidin-2-one (PubChem CID 144620733) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-4-methyl-3-(2-methyl-2-sulfanylpropyl)imidazolidin-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-4-methyl-3-(2-methyl-2-sulfanylpropyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 144620733 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-4-methyl-3-(2-methyl-2-sulfanylpropyl)imidazolidin-2-one |
| SMILES | CC1CN(Cc2nc3ccccc3s2)C(=O)N1CC(C)(C)S |
| InChI | InChI=1S/C16H21N3OS2/c1-11-8-18(15(20)19(11)10-16(2,3)21)9-14-17-12-6-4-5-7-13(12)22-14/h4-7,11,21H,8-10H2,1-3H3 |
| InChIKey | OGJCVPYGCORKMY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|