C27H26ClN3O2S — CID 144621374
N-(3-chloro-5-isoquinolin-1-ylphenyl)-4-[ethyl(propylsulfinyl)amino]benzamide (PubChem CID 144621374) has the molecular formula C27H26ClN3O2S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-(3-chloro-5-isoquinolin-1-ylphenyl)-4-[ethyl(propylsulfinyl)amino]benzamide.
| Compound Name | N-(3-chloro-5-isoquinolin-1-ylphenyl)-4-[ethyl(propylsulfinyl)amino]benzamide |
|---|---|
| PubChem CID | 144621374 |
| Molecular Formula | C27H26ClN3O2S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-(3-chloro-5-isoquinolin-1-ylphenyl)-4-[ethyl(propylsulfinyl)amino]benzamide |
| SMILES | CCCS(=O)N(CC)c1ccc(C(=O)Nc2cc(Cl)cc(-c3nccc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C27H26ClN3O2S/c1-3-15-34(33)31(4-2)24-11-9-20(10-12-24)27(32)30-23-17-21(16-22(28)18-23)26-25-8-6-5-7-19(25)13-14-29-26/h5-14,16-18H,3-4,15H2,1-2H3,(H,30,32) |
| InChIKey | VKPWXXUFGBYFLB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |