C26H20IN3O3S — CID 70934880
5-ethylsulfonyl-N-(4-iodo-3-isoquinolin-1-ylphenyl)-1H-indole-2-carboxamide (PubChem CID 70934880) has the molecular formula C26H20IN3O3S and a molecular weight of 581.44 g/mol. Its IUPAC name is 5-ethylsulfonyl-N-(4-iodo-3-isoquinolin-1-ylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-ethylsulfonyl-N-(4-iodo-3-isoquinolin-1-ylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70934880 |
| Molecular Formula | C26H20IN3O3S |
| Molecular Weight | 581.44 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | 5-ethylsulfonyl-N-(4-iodo-3-isoquinolin-1-ylphenyl)-1H-indole-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc2[nH]c(C(=O)Nc3ccc(I)c(-c4nccc5ccccc45)c3)cc2c1 |
| InChI | InChI=1S/C26H20IN3O3S/c1-2-34(32,33)19-8-10-23-17(13-19)14-24(30-23)26(31)29-18-7-9-22(27)21(15-18)25-20-6-4-3-5-16(20)11-12-28-25/h3-15,30H,2H2,1H3,(H,29,31) |
| InChIKey | SPCOELJUPSGAMB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|