C24H13IN2O4 — CID 89114220
N-(4-iodo-3-isoquinolin-1-ylphenyl)-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 89114220) has the molecular formula C24H13IN2O4 and a molecular weight of 520.28 g/mol. Its IUPAC name is N-(4-iodo-3-isoquinolin-1-ylphenyl)-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-(4-iodo-3-isoquinolin-1-ylphenyl)-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 89114220 |
| Molecular Formula | C24H13IN2O4 |
| Molecular Weight | 520.28 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | N-(4-iodo-3-isoquinolin-1-ylphenyl)-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1ccc(I)c(-c2nccc3ccccc23)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C24H13IN2O4/c25-20-8-6-15(12-19(20)21-16-4-2-1-3-13(16)9-10-26-21)27-22(28)14-5-7-17-18(11-14)24(30)31-23(17)29/h1-12H,(H,27,28) |
| InChIKey | WEUVZJUWMTVXKP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|