C22H14N4O4S — CID 509289
N-[5-(naphthalen-1-ylmethylamino)-1,3,4-thiadiazol-2-yl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 509289) has the molecular formula C22H14N4O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[5-(naphthalen-1-ylmethylamino)-1,3,4-thiadiazol-2-yl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[5-(naphthalen-1-ylmethylamino)-1,3,4-thiadiazol-2-yl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 509289 |
| Molecular Formula | C22H14N4O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[5-(naphthalen-1-ylmethylamino)-1,3,4-thiadiazol-2-yl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1nnc(NCc2cccc3ccccc23)s1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C22H14N4O4S/c27-18(13-8-9-16-17(10-13)20(29)30-19(16)28)24-22-26-25-21(31-22)23-11-14-6-3-5-12-4-1-2-7-15(12)14/h1-10H,11H2,(H,23,25)(H,24,26,27) |
| InChIKey | CUMJNWVJWSROKI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|