C17H11N5O4S — CID 509332
1,3-dioxo-N-[5-(pyridin-4-ylmethylamino)-1,3,4-thiadiazol-2-yl]-2-benzofuran-5-carboxamide (PubChem CID 509332) has the molecular formula C17H11N5O4S and a molecular weight of 381.37 g/mol. Its IUPAC name is 1,3-dioxo-N-[5-(pyridin-4-ylmethylamino)-1,3,4-thiadiazol-2-yl]-2-benzofuran-5-carboxamide.
| Compound Name | 1,3-dioxo-N-[5-(pyridin-4-ylmethylamino)-1,3,4-thiadiazol-2-yl]-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 509332 |
| Molecular Formula | C17H11N5O4S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1,3-dioxo-N-[5-(pyridin-4-ylmethylamino)-1,3,4-thiadiazol-2-yl]-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1nnc(NCc2ccncc2)s1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C17H11N5O4S/c23-13(10-1-2-11-12(7-10)15(25)26-14(11)24)20-17-22-21-16(27-17)19-8-9-3-5-18-6-4-9/h1-7H,8H2,(H,19,21)(H,20,22,23) |
| InChIKey | VOTOIMZLOPRWTE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|