C25H20ClN3O4S — CID 70933669
2-acetamido-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-methylsulfonylbenzamide (PubChem CID 70933669) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is 2-acetamido-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-methylsulfonylbenzamide.
| Compound Name | 2-acetamido-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70933669 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-acetamido-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-methylsulfonylbenzamide |
| SMILES | CC(=O)Nc1cc(S(C)(=O)=O)ccc1C(=O)Nc1ccc(Cl)c(-c2nccc3ccccc23)c1 |
| InChI | InChI=1S/C25H20ClN3O4S/c1-15(30)28-23-14-18(34(2,32)33)8-9-20(23)25(31)29-17-7-10-22(26)21(13-17)24-19-6-4-3-5-16(19)11-12-27-24/h3-14H,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | AIQOQZCYUDBZJD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |