C27H19Cl2N3O3S — CID 70797328
N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(4-chlorophenyl)-4-methylsulfonylbenzamide (PubChem CID 70797328) has the molecular formula C27H19Cl2N3O3S and a molecular weight of 536.44 g/mol. Its IUPAC name is N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(4-chlorophenyl)-4-methylsulfonylbenzamide.
| Compound Name | N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(4-chlorophenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70797328 |
| Molecular Formula | C27H19Cl2N3O3S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(4-chlorophenyl)-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3n[nH]c4ccccc34)c2)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H19Cl2N3O3S/c1-36(34,35)19-11-12-20(22(15-19)16-6-8-17(28)9-7-16)27(33)30-18-10-13-24(29)23(14-18)26-21-4-2-3-5-25(21)31-32-26/h2-15H,1H3,(H,30,33)(H,31,32) |
| InChIKey | BCBJOZUQJHLUMC-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |