C24H18Cl2N2O3S — CID 70797428
2-(3-chlorophenyl)-N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-4-methylsulfonylbenzamide (PubChem CID 70797428) has the molecular formula C24H18Cl2N2O3S and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | 2-(3-chlorophenyl)-N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70797428 |
| Molecular Formula | C24H18Cl2N2O3S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ccc[nH]3)c2)c(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H18Cl2N2O3S/c1-32(30,31)18-8-9-19(20(14-18)15-4-2-5-16(25)12-15)24(29)28-17-7-10-22(26)21(13-17)23-6-3-11-27-23/h2-14,27H,1H3,(H,28,29) |
| InChIKey | LIADIHAYLSBWQE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |