C25H21ClN2O2S — CID 123655059
N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-2-(3-methoxyphenyl)-4-methylsulfanylbenzamide (PubChem CID 123655059) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-2-(3-methoxyphenyl)-4-methylsulfanylbenzamide.
| Compound Name | N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-2-(3-methoxyphenyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 123655059 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[4-chloro-3-(1H-pyrrol-2-yl)phenyl]-2-(3-methoxyphenyl)-4-methylsulfanylbenzamide |
| SMILES | COc1cccc(-c2cc(SC)ccc2C(=O)Nc2ccc(Cl)c(-c3ccc[nH]3)c2)c1 |
| InChI | InChI=1S/C25H21ClN2O2S/c1-30-18-6-3-5-16(13-18)21-15-19(31-2)9-10-20(21)25(29)28-17-8-11-23(26)22(14-17)24-7-4-12-27-24/h3-15,27H,1-2H3,(H,28,29) |
| InChIKey | NSJDBINKTNOSEH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |