C32H29ClN2OS — CID 123794906
2-(4-tert-butylphenyl)-N-[4-chloro-3-(1H-indol-2-yl)phenyl]-4-methylsulfanylbenzamide (PubChem CID 123794906) has the molecular formula C32H29ClN2OS and a molecular weight of 525.12 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[4-chloro-3-(1H-indol-2-yl)phenyl]-4-methylsulfanylbenzamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[4-chloro-3-(1H-indol-2-yl)phenyl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 123794906 |
| Molecular Formula | C32H29ClN2OS |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[4-chloro-3-(1H-indol-2-yl)phenyl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2ccc(Cl)c(-c3cc4ccccc4[nH]3)c2)c(-c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C32H29ClN2OS/c1-32(2,3)22-11-9-20(10-12-22)26-19-24(37-4)14-15-25(26)31(36)34-23-13-16-28(33)27(18-23)30-17-21-7-5-6-8-29(21)35-30/h5-19,35H,1-4H3,(H,34,36) |
| InChIKey | AJWBVRFODXKLOA-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |