C28H22ClN3O3S — CID 70797332
N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(3-methylphenyl)-4-methylsulfonylbenzamide (PubChem CID 70797332) has the molecular formula C28H22ClN3O3S and a molecular weight of 516.02 g/mol. Its IUPAC name is N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(3-methylphenyl)-4-methylsulfonylbenzamide.
| Compound Name | N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(3-methylphenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70797332 |
| Molecular Formula | C28H22ClN3O3S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-[4-chloro-3-(1H-indazol-3-yl)phenyl]-2-(3-methylphenyl)-4-methylsulfonylbenzamide |
| SMILES | Cc1cccc(-c2cc(S(C)(=O)=O)ccc2C(=O)Nc2ccc(Cl)c(-c3n[nH]c4ccccc34)c2)c1 |
| InChI | InChI=1S/C28H22ClN3O3S/c1-17-6-5-7-18(14-17)23-16-20(36(2,34)35)11-12-21(23)28(33)30-19-10-13-25(29)24(15-19)27-22-8-3-4-9-26(22)31-32-27/h3-16H,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | OZSIAZKJTBLLMV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |