C25H21ClN2O4 — CID 71263531
N-(4-chloro-3-isoquinolin-1-ylphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 71263531) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-(4-chloro-3-isoquinolin-1-ylphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(4-chloro-3-isoquinolin-1-ylphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 71263531 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-(4-chloro-3-isoquinolin-1-ylphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(Cl)c(-c3nccc4ccccc34)c2)cc1OC |
| InChI | InChI=1S/C25H21ClN2O4/c1-30-21-14-23(32-3)22(31-2)13-19(21)25(29)28-16-8-9-20(26)18(12-16)24-17-7-5-4-6-15(17)10-11-27-24/h4-14H,1-3H3,(H,28,29) |
| InChIKey | FCUUVMSOHVJTCO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |