C27H24ClN3OS — CID 144621680
2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(thiazinan-2-yl)benzamide (PubChem CID 144621680) has the molecular formula C27H24ClN3OS and a molecular weight of 474.03 g/mol. Its IUPAC name is 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(thiazinan-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(thiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 144621680 |
| Molecular Formula | C27H24ClN3OS |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(thiazinan-2-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCCCS3)cc2Cl)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C27H24ClN3OS/c1-18-8-9-20(16-24(18)26-22-7-3-2-6-19(22)12-13-29-26)30-27(32)23-11-10-21(17-25(23)28)31-14-4-5-15-33-31/h2-3,6-13,16-17H,4-5,14-15H2,1H3,(H,30,32) |
| InChIKey | DIBOXDAUDLSLKZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|