C25H22ClN3O2S2 — CID 144620827
N-[2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline (PubChem CID 144620827) has the molecular formula C25H22ClN3O2S2 and a molecular weight of 496.06 g/mol. Its IUPAC name is N-[2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline.
| Compound Name | N-[2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline |
|---|---|
| PubChem CID | 144620827 |
| Molecular Formula | C25H22ClN3O2S2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | N-[2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline |
| SMILES | Cc1ccc(NSc2ccc(N3CCCS3(=O)=O)cc2Cl)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C25H22ClN3O2S2/c1-17-7-8-19(15-22(17)25-21-6-3-2-5-18(21)11-12-27-25)28-32-24-10-9-20(16-23(24)26)29-13-4-14-33(29,30)31/h2-3,5-12,15-16,28H,4,13-14H2,1H3 |
| InChIKey | SKQVPPCVOTUYBZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|