C24H19Cl2N3OS2 — CID 144621387
4-chloro-N-[2-chloro-4-(1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-3-isoquinolin-1-ylaniline (PubChem CID 144621387) has the molecular formula C24H19Cl2N3OS2 and a molecular weight of 500.48 g/mol. Its IUPAC name is 4-chloro-N-[2-chloro-4-(1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-3-isoquinolin-1-ylaniline.
| Compound Name | 4-chloro-N-[2-chloro-4-(1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-3-isoquinolin-1-ylaniline |
|---|---|
| PubChem CID | 144621387 |
| Molecular Formula | C24H19Cl2N3OS2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 4-chloro-N-[2-chloro-4-(1,4,3-oxathiazinan-3-yl)phenyl]sulfanyl-3-isoquinolin-1-ylaniline |
| SMILES | Clc1cc(N2COCCS2)ccc1SNc1ccc(Cl)c(-c2nccc3ccccc23)c1 |
| InChI | InChI=1S/C24H19Cl2N3OS2/c25-21-7-5-17(13-20(21)24-19-4-2-1-3-16(19)9-10-27-24)28-32-23-8-6-18(14-22(23)26)29-15-30-11-12-31-29/h1-10,13-14,28H,11-12,15H2 |
| InChIKey | VSLVUJAUPNKIPL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|