C25H23ClN4S2 — CID 144621361
N-[2-chloro-4-(1,2,6-thiadiazinan-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline (PubChem CID 144621361) has the molecular formula C25H23ClN4S2 and a molecular weight of 479.07 g/mol. Its IUPAC name is N-[2-chloro-4-(1,2,6-thiadiazinan-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline.
| Compound Name | N-[2-chloro-4-(1,2,6-thiadiazinan-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline |
|---|---|
| PubChem CID | 144621361 |
| Molecular Formula | C25H23ClN4S2 |
| Molecular Weight | 479.07 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[2-chloro-4-(1,2,6-thiadiazinan-2-yl)phenyl]sulfanyl-3-isoquinolin-1-yl-4-methylaniline |
| SMILES | Cc1ccc(NSc2ccc(N3CCCNS3)cc2Cl)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C25H23ClN4S2/c1-17-7-8-19(15-22(17)25-21-6-3-2-5-18(21)11-13-27-25)29-31-24-10-9-20(16-23(24)26)30-14-4-12-28-32-30/h2-3,5-11,13,15-16,28-29H,4,12,14H2,1H3 |
| InChIKey | IYGZDLSVOINUAG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.07 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|