C28H31N5OS — CID 144621442
N-(4-methyl-3-quinazolin-2-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide;propane (PubChem CID 144621442) has the molecular formula C28H31N5OS and a molecular weight of 485.66 g/mol. Its IUPAC name is N-(4-methyl-3-quinazolin-2-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide;propane.
| Compound Name | N-(4-methyl-3-quinazolin-2-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide;propane |
|---|---|
| PubChem CID | 144621442 |
| Molecular Formula | C28H31N5OS |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-(4-methyl-3-quinazolin-2-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide;propane |
| SMILES | CCC.Cc1ccc(NC(=O)c2ccc(N3CCCNS3)cc2)cc1-c1ncc2ccccc2n1 |
| InChI | InChI=1S/C25H23N5OS.C3H8/c1-17-7-10-20(15-22(17)24-26-16-19-5-2-3-6-23(19)29-24)28-25(31)18-8-11-21(12-9-18)30-14-4-13-27-32-30;1-3-2/h2-3,5-12,15-16,27H,4,13-14H2,1H3,(H,28,31);3H2,1-2H3 |
| InChIKey | ODXSZFIQLIQSFH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|