C27H25ClN4O3S — CID 118463035
2-chloro-4-(1,1-dioxothiazepan-2-yl)-N-(4-methyl-3-quinazolin-2-ylphenyl)benzamide (PubChem CID 118463035) has the molecular formula C27H25ClN4O3S and a molecular weight of 521.04 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dioxothiazepan-2-yl)-N-(4-methyl-3-quinazolin-2-ylphenyl)benzamide.
| Compound Name | 2-chloro-4-(1,1-dioxothiazepan-2-yl)-N-(4-methyl-3-quinazolin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 118463035 |
| Molecular Formula | C27H25ClN4O3S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-chloro-4-(1,1-dioxothiazepan-2-yl)-N-(4-methyl-3-quinazolin-2-ylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCCCCS3(=O)=O)cc2Cl)cc1-c1ncc2ccccc2n1 |
| InChI | InChI=1S/C27H25ClN4O3S/c1-18-9-10-20(15-23(18)26-29-17-19-7-3-4-8-25(19)31-26)30-27(33)22-12-11-21(16-24(22)28)32-13-5-2-6-14-36(32,34)35/h3-4,7-12,15-17H,2,5-6,13-14H2,1H3,(H,30,33) |
| InChIKey | KSGHNQVMCLDZQP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |