C17H16Cl2N2O3S — CID 7685757
2-chloro-N-(4-chlorophenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 7685757) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 7685757 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(N2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3S/c18-12-3-5-13(6-4-12)20-17(22)15-8-7-14(11-16(15)19)21-9-1-2-10-25(21,23)24/h3-8,11H,1-2,9-10H2,(H,20,22) |
| InChIKey | IJOJGEPHUWCWKD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |