C17H18ClN3O3S — CID 7658986
2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-(4-methyl-2-pyridinyl)benzamide (PubChem CID 7658986) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-(4-methyl-2-pyridinyl)benzamide.
| Compound Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-(4-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 7658986 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-(4-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccnc(NC(=O)c2ccc(N3CCCCS3(=O)=O)cc2Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3S/c1-12-6-7-19-16(10-12)20-17(22)14-5-4-13(11-15(14)18)21-8-2-3-9-25(21,23)24/h4-7,10-11H,2-3,8-9H2,1H3,(H,19,20,22) |
| InChIKey | PPLOLSPYFIYGKH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |