C14H17ClN2O3S — CID 7685760
2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-prop-2-enylbenzamide (PubChem CID 7685760) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-prop-2-enylbenzamide.
| Compound Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 7685760 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(N2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C14H17ClN2O3S/c1-2-7-16-14(18)12-6-5-11(10-13(12)15)17-8-3-4-9-21(17,19)20/h2,5-6,10H,1,3-4,7-9H2,(H,16,18) |
| InChIKey | CIBPXROZRYNFHF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|