C15H18ClN3O3S — CID 110615002
2-chloro-N-(2-cyanopropan-2-yl)-4-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 110615002) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanopropan-2-yl)-4-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | 2-chloro-N-(2-cyanopropan-2-yl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 110615002 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-chloro-N-(2-cyanopropan-2-yl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | CC(C)(C#N)NC(=O)c1ccc(N2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H18ClN3O3S/c1-15(2,10-17)18-14(20)12-6-5-11(9-13(12)16)19-7-3-4-8-23(19,21)22/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,20) |
| InChIKey | YPPCJGPGMYMZMQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |