C18H18ClN3O4S — CID 7499041
N-(4-carbamoylphenyl)-2-chloro-4-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 7499041) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-2-chloro-4-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | N-(4-carbamoylphenyl)-2-chloro-4-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 7499041 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-(4-carbamoylphenyl)-2-chloro-4-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2ccc(N3CCCCS3(=O)=O)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O4S/c19-16-11-14(22-9-1-2-10-27(22,25)26)7-8-15(16)18(24)21-13-5-3-12(4-6-13)17(20)23/h3-8,11H,1-2,9-10H2,(H2,20,23)(H,21,24) |
| InChIKey | CNPXOAHZNBJYKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |