C16H23ClN2O3S — CID 110295545
2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-pentylbenzamide (PubChem CID 110295545) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-pentylbenzamide.
| Compound Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-pentylbenzamide |
|---|---|
| PubChem CID | 110295545 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(N2CCCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C16H23ClN2O3S/c1-2-3-4-9-18-16(20)14-8-7-13(12-15(14)17)19-10-5-6-11-23(19,21)22/h7-8,12H,2-6,9-11H2,1H3,(H,18,20) |
| InChIKey | GEPXGCORERFOAG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|