C33H40ClFN4OS — CID 144621532
N-(4-chloro-3-quinazolin-2-ylphenyl)-2-fluoro-4-(thiazepan-2-yl)benzamide;ethane;pentane (PubChem CID 144621532) has the molecular formula C33H40ClFN4OS and a molecular weight of 595.23 g/mol. Its IUPAC name is N-(4-chloro-3-quinazolin-2-ylphenyl)-2-fluoro-4-(thiazepan-2-yl)benzamide;ethane;pentane.
| Compound Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-2-fluoro-4-(thiazepan-2-yl)benzamide;ethane;pentane |
|---|---|
| PubChem CID | 144621532 |
| Molecular Formula | C33H40ClFN4OS |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-2-fluoro-4-(thiazepan-2-yl)benzamide;ethane;pentane |
| SMILES | CC.CCCCC.O=C(Nc1ccc(Cl)c(-c2ncc3ccccc3n2)c1)c1ccc(N2CCCCCS2)cc1F |
| InChI | InChI=1S/C26H22ClFN4OS.C5H12.C2H6/c27-22-11-8-18(14-21(22)25-29-16-17-6-2-3-7-24(17)31-25)30-26(33)20-10-9-19(15-23(20)28)32-12-4-1-5-13-34-32;1-3-5-4-2;1-2/h2-3,6-11,14-16H,1,4-5,12-13H2,(H,30,33);3-5H2,1-2H3;1-2H3 |
| InChIKey | KDENCMMUMCURDG-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|