C32H39Cl2N3OS2 — CID 144621089
chloroethane;N-(4-chloro-3-thieno[3,2-c]pyridin-4-ylphenyl)-4-(thiazepan-2-yl)benzamide;pentane (PubChem CID 144621089) has the molecular formula C32H39Cl2N3OS2 and a molecular weight of 616.72 g/mol. Its IUPAC name is chloroethane;N-(4-chloro-3-thieno[3,2-c]pyridin-4-ylphenyl)-4-(thiazepan-2-yl)benzamide;pentane.
| Compound Name | chloroethane;N-(4-chloro-3-thieno[3,2-c]pyridin-4-ylphenyl)-4-(thiazepan-2-yl)benzamide;pentane |
|---|---|
| PubChem CID | 144621089 |
| Molecular Formula | C32H39Cl2N3OS2 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | chloroethane;N-(4-chloro-3-thieno[3,2-c]pyridin-4-ylphenyl)-4-(thiazepan-2-yl)benzamide;pentane |
| SMILES | CCCCC.CCCl.O=C(Nc1ccc(Cl)c(-c2nccc3sccc23)c1)c1ccc(N2CCCCCS2)cc1 |
| InChI | InChI=1S/C25H22ClN3OS2.C5H12.C2H5Cl/c26-22-9-6-18(16-21(22)24-20-11-15-31-23(20)10-12-27-24)28-25(30)17-4-7-19(8-5-17)29-13-2-1-3-14-32-29;1-3-5-4-2;1-2-3/h4-12,15-16H,1-3,13-14H2,(H,28,30);3-5H2,1-2H3;2H2,1H3 |
| InChIKey | HUDHFDKIKMKICH-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|