C30H33ClN4OS — CID 144621463
2-chloro-N-[4-methyl-3-(1,6-naphthyridin-5-yl)phenyl]-4-(thiazepan-2-yl)benzamide;propane (PubChem CID 144621463) has the molecular formula C30H33ClN4OS and a molecular weight of 533.14 g/mol. Its IUPAC name is 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-5-yl)phenyl]-4-(thiazepan-2-yl)benzamide;propane.
| Compound Name | 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-5-yl)phenyl]-4-(thiazepan-2-yl)benzamide;propane |
|---|---|
| PubChem CID | 144621463 |
| Molecular Formula | C30H33ClN4OS |
| Molecular Weight | 533.14 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-chloro-N-[4-methyl-3-(1,6-naphthyridin-5-yl)phenyl]-4-(thiazepan-2-yl)benzamide;propane |
| SMILES | CCC.Cc1ccc(NC(=O)c2ccc(N3CCCCCS3)cc2Cl)cc1-c1nccc2ncccc12 |
| InChI | InChI=1S/C27H25ClN4OS.C3H8/c1-18-7-8-19(16-23(18)26-22-6-5-12-29-25(22)11-13-30-26)31-27(33)21-10-9-20(17-24(21)28)32-14-3-2-4-15-34-32;1-3-2/h5-13,16-17H,2-4,14-15H2,1H3,(H,31,33);3H2,1-2H3 |
| InChIKey | AZBGHCPSMISYFJ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.14 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|