C35H37Cl3N4OS — CID 144621867
buta-1,3-dien-2-amine;(E)-2-chlorobut-2-ene;2-chloro-N-(4-chloro-3-quinolin-2-ylphenyl)-4-(thiazepan-2-yl)benzamide (PubChem CID 144621867) has the molecular formula C35H37Cl3N4OS and a molecular weight of 668.13 g/mol. Its IUPAC name is buta-1,3-dien-2-amine;(E)-2-chlorobut-2-ene;2-chloro-N-(4-chloro-3-quinolin-2-ylphenyl)-4-(thiazepan-2-yl)benzamide.
| Compound Name | buta-1,3-dien-2-amine;(E)-2-chlorobut-2-ene;2-chloro-N-(4-chloro-3-quinolin-2-ylphenyl)-4-(thiazepan-2-yl)benzamide |
|---|---|
| PubChem CID | 144621867 |
| Molecular Formula | C35H37Cl3N4OS |
| Molecular Weight | 668.13 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | buta-1,3-dien-2-amine;(E)-2-chlorobut-2-ene;2-chloro-N-(4-chloro-3-quinolin-2-ylphenyl)-4-(thiazepan-2-yl)benzamide |
| SMILES | C/C=C(\C)Cl.C=CC(=C)N.O=C(Nc1ccc(Cl)c(-c2ccc3ccccc3n2)c1)c1ccc(N2CCCCCS2)cc1Cl |
| InChI | InChI=1S/C27H23Cl2N3OS.C4H7Cl.C4H7N/c28-23-12-9-19(16-22(23)26-13-8-18-6-2-3-7-25(18)31-26)30-27(33)21-11-10-20(17-24(21)29)32-14-4-1-5-15-34-32;2*1-3-4(2)5/h2-3,6-13,16-17H,1,4-5,14-15H2,(H,30,33);3H,1-2H3;3H,1-2,5H2/b;4-3+; |
| InChIKey | IVLCMXQBZFGUHD-ITDJAWRYSA-N |
| XLogP | 10.89 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.13 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|