C18H19Cl2N3OS — CID 146668427
2-chloro-N-[3-chloro-5-(dimethylamino)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide (PubChem CID 146668427) has the molecular formula C18H19Cl2N3OS and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-5-(dimethylamino)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2-chloro-N-[3-chloro-5-(dimethylamino)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 146668427 |
| Molecular Formula | C18H19Cl2N3OS |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-chloro-N-[3-chloro-5-(dimethylamino)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
| SMILES | CN(C)c1cc(Cl)cc(NC(=O)c2cc(N3CCCS3)ccc2Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3OS/c1-22(2)15-9-12(19)8-13(10-15)21-18(24)16-11-14(4-5-17(16)20)23-6-3-7-25-23/h4-5,8-11H,3,6-7H2,1-2H3,(H,21,24) |
| InChIKey | LXXGXLJXWQZGOA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|