C18H16Cl3FN2OS — CID 146668673
2,3-dichloro-N-[3-chloro-5-(1-fluoroethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide (PubChem CID 146668673) has the molecular formula C18H16Cl3FN2OS and a molecular weight of 433.76 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-chloro-5-(1-fluoroethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2,3-dichloro-N-[3-chloro-5-(1-fluoroethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 146668673 |
| Molecular Formula | C18H16Cl3FN2OS |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 2,3-dichloro-N-[3-chloro-5-(1-fluoroethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
| SMILES | CC(F)c1cc(Cl)cc(NC(=O)c2cc(N3CCCS3)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C18H16Cl3FN2OS/c1-10(22)11-5-12(19)7-13(6-11)23-18(25)15-8-14(9-16(20)17(15)21)24-3-2-4-26-24/h5-10H,2-4H2,1H3,(H,23,25) |
| InChIKey | FLSHQENBAJYYDW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|