C21H22Cl3N3OS — CID 146668522
2,3-dichloro-N-(3-chloro-5-piperidin-1-ylphenyl)-5-(1,2-thiazolidin-2-yl)benzamide (PubChem CID 146668522) has the molecular formula C21H22Cl3N3OS and a molecular weight of 470.85 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-chloro-5-piperidin-1-ylphenyl)-5-(1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2,3-dichloro-N-(3-chloro-5-piperidin-1-ylphenyl)-5-(1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 146668522 |
| Molecular Formula | C21H22Cl3N3OS |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2,3-dichloro-N-(3-chloro-5-piperidin-1-ylphenyl)-5-(1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1cc(Cl)cc(N2CCCCC2)c1)c1cc(N2CCCS2)cc(Cl)c1Cl |
| InChI | InChI=1S/C21H22Cl3N3OS/c22-14-9-15(11-16(10-14)26-5-2-1-3-6-26)25-21(28)18-12-17(13-19(23)20(18)24)27-7-4-8-29-27/h9-13H,1-8H2,(H,25,28) |
| InChIKey | ZSTYMSPFIMCRTL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|