C20H19Cl2F3N2OS — CID 146668495
2,3-dichloro-N-[3-propyl-5-(trifluoromethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide (PubChem CID 146668495) has the molecular formula C20H19Cl2F3N2OS and a molecular weight of 463.35 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-propyl-5-(trifluoromethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2,3-dichloro-N-[3-propyl-5-(trifluoromethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 146668495 |
| Molecular Formula | C20H19Cl2F3N2OS |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 2,3-dichloro-N-[3-propyl-5-(trifluoromethyl)phenyl]-5-(1,2-thiazolidin-2-yl)benzamide |
| SMILES | CCCc1cc(NC(=O)c2cc(N3CCCS3)cc(Cl)c2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19Cl2F3N2OS/c1-2-4-12-7-13(20(23,24)25)9-14(8-12)26-19(28)16-10-15(11-17(21)18(16)22)27-5-3-6-29-27/h7-11H,2-6H2,1H3,(H,26,28) |
| InChIKey | ZYDXAGWJPSRBPH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|