C16H13Cl3N2OS — CID 146667435
2,4-dichloro-N-(3-chlorophenyl)-5-(1,2-thiazolidin-2-yl)benzamide (PubChem CID 146667435) has the molecular formula C16H13Cl3N2OS and a molecular weight of 387.72 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-chlorophenyl)-5-(1,2-thiazolidin-2-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(3-chlorophenyl)-5-(1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 146667435 |
| Molecular Formula | C16H13Cl3N2OS |
| Molecular Weight | 387.72 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2,4-dichloro-N-(3-chlorophenyl)-5-(1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(N2CCCS2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2OS/c17-10-3-1-4-11(7-10)20-16(22)12-8-15(14(19)9-13(12)18)21-5-2-6-23-21/h1,3-4,7-9H,2,5-6H2,(H,20,22) |
| InChIKey | BXGJHLLITHPERQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|