C28H31ClN4OS2 — CID 144621193
butane;N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(thiazinan-2-yl)benzenesulfinamide (PubChem CID 144621193) has the molecular formula C28H31ClN4OS2 and a molecular weight of 539.17 g/mol. Its IUPAC name is butane;N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(thiazinan-2-yl)benzenesulfinamide.
| Compound Name | butane;N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(thiazinan-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 144621193 |
| Molecular Formula | C28H31ClN4OS2 |
| Molecular Weight | 539.17 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | butane;N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(thiazinan-2-yl)benzenesulfinamide |
| SMILES | CCCC.O=S(Nc1ccc(Cl)c(-c2ncc3ccccc3n2)c1)c1ccc(N2CCCCS2)cc1 |
| InChI | InChI=1S/C24H21ClN4OS2.C4H10/c25-22-12-7-18(15-21(22)24-26-16-17-5-1-2-6-23(17)27-24)28-32(30)20-10-8-19(9-11-20)29-13-3-4-14-31-29;1-3-4-2/h1-2,5-12,15-16,28H,3-4,13-14H2;3-4H2,1-2H3 |
| InChIKey | QVIVIGAVUHPYMI-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.17 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|