C29H38N4OS — CID 144621888
N-[(E)-but-2-en-2-yl]propan-1-imine;ethane;N-quinolin-7-yl-4-(thiazinan-2-yl)benzamide (PubChem CID 144621888) has the molecular formula C29H38N4OS and a molecular weight of 490.72 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]propan-1-imine;ethane;N-quinolin-7-yl-4-(thiazinan-2-yl)benzamide.
| Compound Name | N-[(E)-but-2-en-2-yl]propan-1-imine;ethane;N-quinolin-7-yl-4-(thiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 144621888 |
| Molecular Formula | C29H38N4OS |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]propan-1-imine;ethane;N-quinolin-7-yl-4-(thiazinan-2-yl)benzamide |
| SMILES | C/C=C(C)/N=C/CC.CC.O=C(Nc1ccc2cccnc2c1)c1ccc(N2CCCCS2)cc1 |
| InChI | InChI=1S/C20H19N3OS.C7H13N.C2H6/c24-20(22-17-8-5-15-4-3-11-21-19(15)14-17)16-6-9-18(10-7-16)23-12-1-2-13-25-23;1-4-6-8-7(3)5-2;1-2/h3-11,14H,1-2,12-13H2,(H,22,24);5-6H,4H2,1-3H3;1-2H3/b;7-5+,8-6+; |
| InChIKey | NWTMKHLJJUQMAK-UJPCKICKSA-N |
| XLogP | 8.15 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|