C30H39N3O2S — CID 144621534
N-(1,3-benzoxazol-5-yl)-4-(thiazepan-2-yl)benzamide;butane;(4Z)-3-methylidenehexa-1,4-diene (PubChem CID 144621534) has the molecular formula C30H39N3O2S and a molecular weight of 505.73 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-4-(thiazepan-2-yl)benzamide;butane;(4Z)-3-methylidenehexa-1,4-diene.
| Compound Name | N-(1,3-benzoxazol-5-yl)-4-(thiazepan-2-yl)benzamide;butane;(4Z)-3-methylidenehexa-1,4-diene |
|---|---|
| PubChem CID | 144621534 |
| Molecular Formula | C30H39N3O2S |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-4-(thiazepan-2-yl)benzamide;butane;(4Z)-3-methylidenehexa-1,4-diene |
| SMILES | C=CC(=C)/C=C\C.CCCC.O=C(Nc1ccc2ocnc2c1)c1ccc(N2CCCCCS2)cc1 |
| InChI | InChI=1S/C19H19N3O2S.C7H10.C4H10/c23-19(21-15-6-9-18-17(12-15)20-13-24-18)14-4-7-16(8-5-14)22-10-2-1-3-11-25-22;1-4-6-7(3)5-2;1-3-4-2/h4-9,12-13H,1-3,10-11H2,(H,21,23);4-6H,2-3H2,1H3;3-4H2,1-2H3/b;6-4-; |
| InChIKey | ANGIFZKIHLYCEA-GONQOWGMSA-N |
| XLogP | 8.83 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|