C27H32ClN3O2S — CID 144621649
N-[4-chloro-3-(4-methoxy-2-pyridinyl)phenyl]-4-(thiazepan-2-yl)benzamide;propane (PubChem CID 144621649) has the molecular formula C27H32ClN3O2S and a molecular weight of 498.09 g/mol. Its IUPAC name is N-[4-chloro-3-(4-methoxy-2-pyridinyl)phenyl]-4-(thiazepan-2-yl)benzamide;propane.
| Compound Name | N-[4-chloro-3-(4-methoxy-2-pyridinyl)phenyl]-4-(thiazepan-2-yl)benzamide;propane |
|---|---|
| PubChem CID | 144621649 |
| Molecular Formula | C27H32ClN3O2S |
| Molecular Weight | 498.09 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-[4-chloro-3-(4-methoxy-2-pyridinyl)phenyl]-4-(thiazepan-2-yl)benzamide;propane |
| SMILES | CCC.COc1ccnc(-c2cc(NC(=O)c3ccc(N4CCCCCS4)cc3)ccc2Cl)c1 |
| InChI | InChI=1S/C24H24ClN3O2S.C3H8/c1-30-20-11-12-26-23(16-20)21-15-18(7-10-22(21)25)27-24(29)17-5-8-19(9-6-17)28-13-3-2-4-14-31-28;1-3-2/h5-12,15-16H,2-4,13-14H2,1H3,(H,27,29);3H2,1-2H3 |
| InChIKey | DBLKMERPGHVORM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.09 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|