C27H29ClN4O2S — CID 144621480
butane;N-(4-chloro-3-furo[3,2-c]pyridin-4-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide (PubChem CID 144621480) has the molecular formula C27H29ClN4O2S and a molecular weight of 509.08 g/mol. Its IUPAC name is butane;N-(4-chloro-3-furo[3,2-c]pyridin-4-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide.
| Compound Name | butane;N-(4-chloro-3-furo[3,2-c]pyridin-4-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 144621480 |
| Molecular Formula | C27H29ClN4O2S |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | butane;N-(4-chloro-3-furo[3,2-c]pyridin-4-ylphenyl)-4-(1,2,6-thiadiazinan-2-yl)benzamide |
| SMILES | CCCC.O=C(Nc1ccc(Cl)c(-c2nccc3occc23)c1)c1ccc(N2CCCNS2)cc1 |
| InChI | InChI=1S/C23H19ClN4O2S.C4H10/c24-20-7-4-16(14-19(20)22-18-9-13-30-21(18)8-11-25-22)27-23(29)15-2-5-17(6-3-15)28-12-1-10-26-31-28;1-3-4-2/h2-9,11,13-14,26H,1,10,12H2,(H,27,29);3-4H2,1-2H3 |
| InChIKey | VNHHHYBVDIYCBM-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|