C26H35N3O2S — CID 144621300
N-(1,3-benzoxazol-5-yl)-4-(thiazinan-2-yl)benzamide;butane;but-1-ene (PubChem CID 144621300) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-4-(thiazinan-2-yl)benzamide;butane;but-1-ene.
| Compound Name | N-(1,3-benzoxazol-5-yl)-4-(thiazinan-2-yl)benzamide;butane;but-1-ene |
|---|---|
| PubChem CID | 144621300 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-4-(thiazinan-2-yl)benzamide;butane;but-1-ene |
| SMILES | C=CCC.CCCC.O=C(Nc1ccc2ocnc2c1)c1ccc(N2CCCCS2)cc1 |
| InChI | InChI=1S/C18H17N3O2S.C4H10.C4H8/c22-18(20-14-5-8-17-16(11-14)19-12-23-17)13-3-6-15(7-4-13)21-9-1-2-10-24-21;2*1-3-4-2/h3-8,11-12H,1-2,9-10H2,(H,20,22);3-4H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | MEBYRPSZLQOOBW-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|