C20H23N3O4S — CID 144621965
N-(1,3-benzoxazol-5-yl)-4-(1,3,4-oxathiazinan-4-yl)benzamide;methoxyethane (PubChem CID 144621965) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-4-(1,3,4-oxathiazinan-4-yl)benzamide;methoxyethane.
| Compound Name | N-(1,3-benzoxazol-5-yl)-4-(1,3,4-oxathiazinan-4-yl)benzamide;methoxyethane |
|---|---|
| PubChem CID | 144621965 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-4-(1,3,4-oxathiazinan-4-yl)benzamide;methoxyethane |
| SMILES | CCOC.O=C(Nc1ccc2ocnc2c1)c1ccc(N2CCOCS2)cc1 |
| InChI | InChI=1S/C17H15N3O3S.C3H8O/c21-17(19-13-3-6-16-15(9-13)18-10-23-16)12-1-4-14(5-2-12)20-7-8-22-11-24-20;1-3-4-2/h1-6,9-10H,7-8,11H2,(H,19,21);3H2,1-2H3 |
| InChIKey | ODPZTJMMDCYTLV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|