C31H36Cl2FN3O4S — CID 144621851
N-[3-[(3-chlorobenzoyl)amino]-4-methylphenyl]-2-fluoro-4-(1,3,4-oxathiazinan-4-yl)benzamide;(E)-2-chlorobut-2-ene;methoxyethane (PubChem CID 144621851) has the molecular formula C31H36Cl2FN3O4S and a molecular weight of 636.62 g/mol. Its IUPAC name is N-[3-[(3-chlorobenzoyl)amino]-4-methylphenyl]-2-fluoro-4-(1,3,4-oxathiazinan-4-yl)benzamide;(E)-2-chlorobut-2-ene;methoxyethane.
| Compound Name | N-[3-[(3-chlorobenzoyl)amino]-4-methylphenyl]-2-fluoro-4-(1,3,4-oxathiazinan-4-yl)benzamide;(E)-2-chlorobut-2-ene;methoxyethane |
|---|---|
| PubChem CID | 144621851 |
| Molecular Formula | C31H36Cl2FN3O4S |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | N-[3-[(3-chlorobenzoyl)amino]-4-methylphenyl]-2-fluoro-4-(1,3,4-oxathiazinan-4-yl)benzamide;(E)-2-chlorobut-2-ene;methoxyethane |
| SMILES | C/C=C(\C)Cl.CCOC.Cc1ccc(NC(=O)c2ccc(N3CCOCS3)cc2F)cc1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClFN3O3S.C4H7Cl.C3H8O/c1-15-5-6-18(12-22(15)28-23(30)16-3-2-4-17(25)11-16)27-24(31)20-8-7-19(13-21(20)26)29-9-10-32-14-33-29;1-3-4(2)5;1-3-4-2/h2-8,11-13H,9-10,14H2,1H3,(H,27,31)(H,28,30);3H,1-2H3;3H2,1-2H3/b;4-3+; |
| InChIKey | QGLSAXGSYPPGPC-ITDJAWRYSA-N |
| XLogP | 8.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|