C26H23ClN4OS — CID 144621827
2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(1-methylidene-1,2,5-thiadiazolidin-2-yl)benzamide (PubChem CID 144621827) has the molecular formula C26H23ClN4OS and a molecular weight of 475.02 g/mol. Its IUPAC name is 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(1-methylidene-1,2,5-thiadiazolidin-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(1-methylidene-1,2,5-thiadiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 144621827 |
| Molecular Formula | C26H23ClN4OS |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-chloro-N-(3-isoquinolin-1-yl-4-methylphenyl)-4-(1-methylidene-1,2,5-thiadiazolidin-2-yl)benzamide |
| SMILES | C=S1NCCN1c1ccc(C(=O)Nc2ccc(C)c(-c3nccc4ccccc34)c2)c(Cl)c1 |
| InChI | InChI=1S/C26H23ClN4OS/c1-17-7-8-19(15-23(17)25-21-6-4-3-5-18(21)11-12-28-25)30-26(32)22-10-9-20(16-24(22)27)31-14-13-29-33(31)2/h3-12,15-16,29H,2,13-14H2,1H3,(H,30,32) |
| InChIKey | WDYAUUVURFEQDU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|