C22H15ClN4OS — CID 89411023
1-(4-chloro-3-isoquinolin-1-ylphenyl)-3-(4-nitrosophenyl)thiourea (PubChem CID 89411023) has the molecular formula C22H15ClN4OS and a molecular weight of 418.91 g/mol. Its IUPAC name is 1-(4-chloro-3-isoquinolin-1-ylphenyl)-3-(4-nitrosophenyl)thiourea.
| Compound Name | 1-(4-chloro-3-isoquinolin-1-ylphenyl)-3-(4-nitrosophenyl)thiourea |
|---|---|
| PubChem CID | 89411023 |
| Molecular Formula | C22H15ClN4OS |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1-(4-chloro-3-isoquinolin-1-ylphenyl)-3-(4-nitrosophenyl)thiourea |
| SMILES | O=Nc1ccc(NC(=S)Nc2ccc(Cl)c(-c3nccc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C22H15ClN4OS/c23-20-10-9-17(26-22(29)25-15-5-7-16(27-28)8-6-15)13-19(20)21-18-4-2-1-3-14(18)11-12-24-21/h1-13H,(H2,25,26,29) |
| InChIKey | GYZFURZHDVNPLC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|