About (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol
(4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol (PubChem CID 144623402) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol.
Molecular Properties
| Compound Name | (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol |
| PubChem CID | 144623402 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol |
| SMILES | CCc1ccc(OC)cc1[C@@H]1CCN(C)C(C)C1O |
| InChI | InChI=1S/C16H25NO2/c1-5-12-6-7-13(19-4)10-15(12)14-8-9-17(3)11(2)16(14)18/h6-7,10-11,14,16,18H,5,8-9H2,1-4H3/t11?,14-,16?/m0/s1 |
| InChIKey | JCUBQZVONPGRDW-WMEQCIOUSA-N |
| XLogP | 2.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol?
The IUPAC name of (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol (CID 144623402) is (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol.
What is the SMILES notation for (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol?
The canonical SMILES for (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol is CCc1ccc(OC)cc1[C@@H]1CCN(C)C(C)C1O.
What is the InChIKey of (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol?
The InChIKey is JCUBQZVONPGRDW-WMEQCIOUSA-N. The full InChI is InChI=1S/C16H25NO2/c1-5-12-6-7-13(19-4)10-15(12)14-8-9-17(3)11(2)16(14)18/h6-7,10-11,14,16,18H,5,8-9H2,1-4H3/t11?,14-,16?/m0/s1.
What are the key properties of (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol?
(4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol has a molecular weight of 263.38 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2-ethyl-5-methoxyphenyl)-1,2-dimethylpiperidin-3-ol is sourced from PubChem (CID 144623402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).